C14H22ClN3O3S — CID 168638629
1-chloro-3-[3-(4-methylpiperazin-1-yl)sulfonylanilino]propan-2-ol (PubChem CID 168638629) has the molecular formula C14H22ClN3O3S and a molecular weight of 347.87 g/mol. Its IUPAC name is 1-chloro-3-[3-(4-methylpiperazin-1-yl)sulfonylanilino]propan-2-ol.
| Compound Name | 1-chloro-3-[3-(4-methylpiperazin-1-yl)sulfonylanilino]propan-2-ol |
|---|---|
| PubChem CID | 168638629 |
| Molecular Formula | C14H22ClN3O3S |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 1-chloro-3-[3-(4-methylpiperazin-1-yl)sulfonylanilino]propan-2-ol |
| SMILES | CN1CCN(S(=O)(=O)c2cccc(NCC(O)CCl)c2)CC1 |
| InChI | InChI=1S/C14H22ClN3O3S/c1-17-5-7-18(8-6-17)22(20,21)14-4-2-3-12(9-14)16-11-13(19)10-15/h2-4,9,13,16,19H,5-8,10-11H2,1H3 |
| InChIKey | YIKBYZIWPLSSML-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|