C15H21ClN2O5S — CID 168639353
1-[3-[(3-chloro-2-hydroxypropyl)amino]phenyl]sulfonylpiperidine-2-carboxylic acid (PubChem CID 168639353) has the molecular formula C15H21ClN2O5S and a molecular weight of 376.86 g/mol. Its IUPAC name is 1-[3-[(3-chloro-2-hydroxypropyl)amino]phenyl]sulfonylpiperidine-2-carboxylic acid.
| Compound Name | 1-[3-[(3-chloro-2-hydroxypropyl)amino]phenyl]sulfonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 168639353 |
| Molecular Formula | C15H21ClN2O5S |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 1-[3-[(3-chloro-2-hydroxypropyl)amino]phenyl]sulfonylpiperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1S(=O)(=O)c1cccc(NCC(O)CCl)c1 |
| InChI | InChI=1S/C15H21ClN2O5S/c16-9-12(19)10-17-11-4-3-5-13(8-11)24(22,23)18-7-2-1-6-14(18)15(20)21/h3-5,8,12,14,17,19H,1-2,6-7,9-10H2,(H,20,21) |
| InChIKey | NAXKUABLQTZELP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|