C25H28N2O7 — CID 168648815
dimethyl 1-[2-(3-ethoxycarbonylpiperidine-1-carbonyl)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168648815) has the molecular formula C25H28N2O7 and a molecular weight of 468.51 g/mol. Its IUPAC name is dimethyl 1-[2-(3-ethoxycarbonylpiperidine-1-carbonyl)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[2-(3-ethoxycarbonylpiperidine-1-carbonyl)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168648815 |
| Molecular Formula | C25H28N2O7 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | dimethyl 1-[2-(3-ethoxycarbonylpiperidine-1-carbonyl)phenyl]azepine-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2ccccc2N2C=CC=CC(C(=O)OC)=C2C(=O)OC)C1 |
| InChI | InChI=1S/C25H28N2O7/c1-4-34-23(29)17-10-9-14-26(16-17)22(28)18-11-5-6-13-20(18)27-15-8-7-12-19(24(30)32-2)21(27)25(31)33-3/h5-8,11-13,15,17H,4,9-10,14,16H2,1-3H3 |
| InChIKey | LLXYDSLQQDFYLY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|