C25H27N3O4 — CID 168649315
dimethyl 1-[4-(4-pyrrol-1-ylpiperidin-1-yl)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168649315) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is dimethyl 1-[4-(4-pyrrol-1-ylpiperidin-1-yl)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[4-(4-pyrrol-1-ylpiperidin-1-yl)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168649315 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | dimethyl 1-[4-(4-pyrrol-1-ylpiperidin-1-yl)phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(N3CCC(n4cccc4)CC3)cc2)C=CC=C1 |
| InChI | InChI=1S/C25H27N3O4/c1-31-24(29)22-7-3-4-16-28(23(22)25(30)32-2)21-10-8-19(9-11-21)27-17-12-20(13-18-27)26-14-5-6-15-26/h3-11,14-16,20H,12-13,17-18H2,1-2H3 |
| InChIKey | HXCUHEDRWSSNQY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|