C19H15N3O4 — CID 168650059
dimethyl 1-(2,4-dicyano-6-methylphenyl)azepine-2,3-dicarboxylate (PubChem CID 168650059) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is dimethyl 1-(2,4-dicyano-6-methylphenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(2,4-dicyano-6-methylphenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168650059 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | dimethyl 1-(2,4-dicyano-6-methylphenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2c(C)cc(C#N)cc2C#N)C=CC=C1 |
| InChI | InChI=1S/C19H15N3O4/c1-12-8-13(10-20)9-14(11-21)16(12)22-7-5-4-6-15(18(23)25-2)17(22)19(24)26-3/h4-9H,1-3H3 |
| InChIKey | ULMBTRGRXHRLKJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 103.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |