C26H32N2O7 — CID 168650206
dimethyl 1-[4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]oxyphenyl]azepine-2,3-dicarboxylate (PubChem CID 168650206) has the molecular formula C26H32N2O7 and a molecular weight of 484.55 g/mol. Its IUPAC name is dimethyl 1-[4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]oxyphenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]oxyphenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168650206 |
| Molecular Formula | C26H32N2O7 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | dimethyl 1-[4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]oxyphenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(OC3CCCN(C(=O)OC(C)(C)C)C3)cc2)C=CC=C1 |
| InChI | InChI=1S/C26H32N2O7/c1-26(2,3)35-25(31)27-15-8-9-20(17-27)34-19-13-11-18(12-14-19)28-16-7-6-10-21(23(29)32-4)22(28)24(30)33-5/h6-7,10-14,16,20H,8-9,15,17H2,1-5H3 |
| InChIKey | JZELJKOVDXIMCR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|