C10H18ClNO3S — CID 168672749
[1-(2-methylbutan-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168672749) has the molecular formula C10H18ClNO3S and a molecular weight of 267.78 g/mol. Its IUPAC name is [1-(2-methylbutan-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [1-(2-methylbutan-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168672749 |
| Molecular Formula | C10H18ClNO3S |
| Molecular Weight | 267.78 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | [1-(2-methylbutan-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | CCC(C)(C)N1CC(CS(=O)(=O)Cl)CC1=O |
| InChI | InChI=1S/C10H18ClNO3S/c1-4-10(2,3)12-6-8(5-9(12)13)7-16(11,14)15/h8H,4-7H2,1-3H3 |
| InChIKey | MFNQIFYZAOCVNP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.78 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |