C12H21FN2O5S — CID 168675089
tert-butyl N-[2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]ethyl]carbamate (PubChem CID 168675089) has the molecular formula C12H21FN2O5S and a molecular weight of 324.37 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 168675089 |
| Molecular Formula | C12H21FN2O5S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | tert-butyl N-[2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C12H21FN2O5S/c1-12(2,3)20-11(17)14-4-5-15-7-9(6-10(15)16)8-21(13,18)19/h9H,4-8H2,1-3H3,(H,14,17) |
| InChIKey | DEYPNLPLBHICAT-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |