C10H17FN2O4S — CID 168675281
[5-oxo-1-[2-oxo-2-(propylamino)ethyl]pyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168675281) has the molecular formula C10H17FN2O4S and a molecular weight of 280.32 g/mol. Its IUPAC name is [5-oxo-1-[2-oxo-2-(propylamino)ethyl]pyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [5-oxo-1-[2-oxo-2-(propylamino)ethyl]pyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168675281 |
| Molecular Formula | C10H17FN2O4S |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | [5-oxo-1-[2-oxo-2-(propylamino)ethyl]pyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | CCCNC(=O)CN1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C10H17FN2O4S/c1-2-3-12-9(14)6-13-5-8(4-10(13)15)7-18(11,16)17/h8H,2-7H2,1H3,(H,12,14) |
| InChIKey | NKUAGUAOKWDVMF-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |