About 1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidine-3-sulfonyl fluoride
1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168713551) has the molecular formula C11H18FNO6S
and a molecular weight of 311.33 g/mol. Its IUPAC name is 1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidine-3-sulfonyl fluoride.
Molecular Properties
| Compound Name | 1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidine-3-sulfonyl fluoride |
| PubChem CID | 168713551 |
| Molecular Formula | C11H18FNO6S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | CC1(C)OCC(CO)(N2CC(S(=O)(=O)F)CC2=O)CO1 |
| InChI | InChI=1S/C11H18FNO6S/c1-10(2)18-6-11(5-14,7-19-10)13-4-8(3-9(13)15)20(12,16)17/h8,14H,3-7H2,1-2H3 |
| InChIKey | HEBQRYWRBXQSDH-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidine-3-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidine-3-sulfonyl fluoride?
The IUPAC name of 1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidine-3-sulfonyl fluoride (CID 168713551) is 1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidine-3-sulfonyl fluoride.
What is the SMILES notation for 1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidine-3-sulfonyl fluoride?
The canonical SMILES for 1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidine-3-sulfonyl fluoride is CC1(C)OCC(CO)(N2CC(S(=O)(=O)F)CC2=O)CO1.
What is the InChIKey of 1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidine-3-sulfonyl fluoride?
The InChIKey is HEBQRYWRBXQSDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18FNO6S/c1-10(2)18-6-11(5-14,7-19-10)13-4-8(3-9(13)15)20(12,16)17/h8,14H,3-7H2,1-2H3.
What are the key properties of 1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidine-3-sulfonyl fluoride?
1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidine-3-sulfonyl fluoride has a molecular weight of 311.33 g/mol, XLogP of -0.60, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidine-3-sulfonyl fluoride is sourced from PubChem (CID 168713551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).