C33H32IrN2Si+ — CID 168721183
iridium(3+);1-methanidyl-3-methyl-2-phenylpyridin-1-ium;trimethyl-(5-phenyl-2-phenyl-4-pyridinyl)silane (PubChem CID 168721183) has the molecular formula C33H32IrN2Si+ and a molecular weight of 676.94 g/mol. Its IUPAC name is iridium(3+);1-methanidyl-3-methyl-2-phenylpyridin-1-ium;trimethyl-(5-phenyl-2-phenyl-4-pyridinyl)silane.
| Compound Name | iridium(3+);1-methanidyl-3-methyl-2-phenylpyridin-1-ium;trimethyl-(5-phenyl-2-phenyl-4-pyridinyl)silane |
|---|---|
| PubChem CID | 168721183 |
| Molecular Formula | C33H32IrN2Si+ |
| Molecular Weight | 676.94 g/mol |
| Exact Mass | 677.20 |
| IUPAC Name | iridium(3+);1-methanidyl-3-methyl-2-phenylpyridin-1-ium;trimethyl-(5-phenyl-2-phenyl-4-pyridinyl)silane |
| SMILES | C[Si](C)(C)c1cc(-c2[c-]cccc2)ncc1-c1ccccc1.[CH2-][n+]1cccc(C)c1-c1[c-]cccc1.[Ir+3] |
| InChI | InChI=1S/C20H20NSi.C13H12N.Ir/c1-22(2,3)20-14-19(17-12-8-5-9-13-17)21-15-18(20)16-10-6-4-7-11-16;1-11-7-6-10-14(2)13(11)12-8-4-3-5-9-12;/h4-12,14-15H,1-3H3;3-8,10H,2H2,1H3;/q2*-1;+3 |
| InChIKey | FMBSLZDYBBLOFJ-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.94 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|