C27H23N5O — CID 168721434
2-[4,4-dimethyl-3-(5-pyrido[2,3-b]indol-9-yl-1H-pyrrol-2-yl)-2H-pyrimidin-3-ium-2-id-1-yl]phenol (PubChem CID 168721434) has the molecular formula C27H23N5O and a molecular weight of 433.52 g/mol. Its IUPAC name is 2-[4,4-dimethyl-3-(5-pyrido[2,3-b]indol-9-yl-1H-pyrrol-2-yl)-2H-pyrimidin-3-ium-2-id-1-yl]phenol.
| Compound Name | 2-[4,4-dimethyl-3-(5-pyrido[2,3-b]indol-9-yl-1H-pyrrol-2-yl)-2H-pyrimidin-3-ium-2-id-1-yl]phenol |
|---|---|
| PubChem CID | 168721434 |
| Molecular Formula | C27H23N5O |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 2-[4,4-dimethyl-3-(5-pyrido[2,3-b]indol-9-yl-1H-pyrrol-2-yl)-2H-pyrimidin-3-ium-2-id-1-yl]phenol |
| SMILES | CC1(C)C=CN(c2ccccc2O)[C-]=[N+]1c1ccc(-n2c3ccccc3c3cccnc32)[nH]1 |
| InChI | InChI=1S/C27H23N5O/c1-27(2)15-17-30(22-11-5-6-12-23(22)33)18-31(27)24-13-14-25(29-24)32-21-10-4-3-8-19(21)20-9-7-16-28-26(20)32/h3-17,29,33H,1-2H3 |
| InChIKey | GRWZVWQUZFCNML-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 60.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|