C24H24GeN — CID 168743573
CID 168743573 (PubChem CID 168743573) has the molecular formula C24H24GeN and a molecular weight of 399.07 g/mol.
| Compound Name | CID 168743573 |
|---|---|
| PubChem CID | 168743573 |
| Molecular Formula | C24H24GeN |
| Molecular Weight | 399.07 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | — |
| SMILES | C=C/C=C(\C)c1cc(-c2cc(C(C)(C)C)c3ccccc3c2)ncc1[Ge] |
| InChI | InChI=1S/C24H24GeN/c1-6-9-16(2)20-14-23(26-15-22(20)25)18-12-17-10-7-8-11-19(17)21(13-18)24(3,4)5/h6-15H,1H2,2-5H3/b16-9+ |
| InChIKey | FPPWBGNCTRRWRW-CXUHLZMHSA-N |
| XLogP | 5.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.07 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|