C61H51N5 — CID 168747883
3-tert-butyl-6-carbazol-9-yl-9-[2-[(2Z,4Z)-hexa-2,4-dienyl]-4-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-6-phenyl-1,3,5-triazin-2-yl]-6-phenylphenyl]carbazole (PubChem CID 168747883) has the molecular formula C61H51N5 and a molecular weight of 854.11 g/mol. Its IUPAC name is 3-tert-butyl-6-carbazol-9-yl-9-[2-[(2Z,4Z)-hexa-2,4-dienyl]-4-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-6-phenyl-1,3,5-triazin-2-yl]-6-phenylphenyl]carbazole.
| Compound Name | 3-tert-butyl-6-carbazol-9-yl-9-[2-[(2Z,4Z)-hexa-2,4-dienyl]-4-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-6-phenyl-1,3,5-triazin-2-yl]-6-phenylphenyl]carbazole |
|---|---|
| PubChem CID | 168747883 |
| Molecular Formula | C61H51N5 |
| Molecular Weight | 854.11 g/mol |
| Exact Mass | 853.41 |
| IUPAC Name | 3-tert-butyl-6-carbazol-9-yl-9-[2-[(2Z,4Z)-hexa-2,4-dienyl]-4-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-6-phenyl-1,3,5-triazin-2-yl]-6-phenylphenyl]carbazole |
| SMILES | C=C/C=C\C=C\c1nc(-c2ccccc2)nc(-c2cc(C/C=C\C=C/C)c(-n3c4ccc(-n5c6ccccc6c6ccccc65)cc4c4cc(C(C)(C)C)ccc43)c(-c3ccccc3)c2)n1 |
| InChI | InChI=1S/C61H51N5/c1-6-8-10-14-28-44-38-45(60-63-57(33-19-11-9-7-2)62-59(64-60)43-26-17-13-18-27-43)39-50(42-24-15-12-16-25-42)58(44)66-55-36-34-46(61(3,4)5)40-51(55)52-41-47(35-37-56(52)66)65-53-31-22-20-29-48(53)49-30-21-23-32-54(49)65/h6-27,29-41H,2,28H2,1,3-5H3/b8-6-,11-9-,14-10-,33-19+ |
| InChIKey | SFPIWWIAWSCTGE-DBFMQVLBSA-N |
| XLogP | 15.79 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.11 |
| LogP ≤ 5 | 15.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|