C58H42N6 — CID 168784073
3-carbazol-9-yl-9-[2-[(2Z,4Z)-hexa-2,4-dienyl]-4-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-6-phenyl-1,3,5-triazin-2-yl]-6-phenylphenyl]-6-isocyanocarbazole (PubChem CID 168784073) has the molecular formula C58H42N6 and a molecular weight of 823.02 g/mol. Its IUPAC name is 3-carbazol-9-yl-9-[2-[(2Z,4Z)-hexa-2,4-dienyl]-4-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-6-phenyl-1,3,5-triazin-2-yl]-6-phenylphenyl]-6-isocyanocarbazole.
| Compound Name | 3-carbazol-9-yl-9-[2-[(2Z,4Z)-hexa-2,4-dienyl]-4-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-6-phenyl-1,3,5-triazin-2-yl]-6-phenylphenyl]-6-isocyanocarbazole |
|---|---|
| PubChem CID | 168784073 |
| Molecular Formula | C58H42N6 |
| Molecular Weight | 823.02 g/mol |
| Exact Mass | 822.35 |
| IUPAC Name | 3-carbazol-9-yl-9-[2-[(2Z,4Z)-hexa-2,4-dienyl]-4-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-6-phenyl-1,3,5-triazin-2-yl]-6-phenylphenyl]-6-isocyanocarbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(-n3c4ccccc4c4ccccc43)ccc1n2-c1c(C/C=C\C=C/C)cc(-c2nc(/C=C/C=C\C=C)nc(-c3ccccc3)n2)cc1-c1ccccc1 |
| InChI | InChI=1S/C58H42N6/c1-4-6-8-12-26-42-36-43(58-61-55(31-17-9-7-5-2)60-57(62-58)41-24-15-11-16-25-41)37-48(40-22-13-10-14-23-40)56(42)64-53-34-32-44(59-3)38-49(53)50-39-45(33-35-54(50)64)63-51-29-20-18-27-46(51)47-28-19-21-30-52(47)63/h4-25,27-39H,2,26H2,1H3/b6-4-,9-7-,12-8-,31-17+ |
| InChIKey | NMDAIJMSHVTRLK-UIGVVFTASA-N |
| XLogP | 15.05 |
| TPSA | 52.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.02 |
| LogP ≤ 5 | 15.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|