C26H34BrN3O2 — CID 168791869
benzyl 4-[4-(4-bromophenyl)piperazin-1-yl]-3-piperidin-1-ylbutanoate (PubChem CID 168791869) has the molecular formula C26H34BrN3O2 and a molecular weight of 500.48 g/mol. Its IUPAC name is benzyl 4-[4-(4-bromophenyl)piperazin-1-yl]-3-piperidin-1-ylbutanoate.
| Compound Name | benzyl 4-[4-(4-bromophenyl)piperazin-1-yl]-3-piperidin-1-ylbutanoate |
|---|---|
| PubChem CID | 168791869 |
| Molecular Formula | C26H34BrN3O2 |
| Molecular Weight | 500.48 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | benzyl 4-[4-(4-bromophenyl)piperazin-1-yl]-3-piperidin-1-ylbutanoate |
| SMILES | O=C(CC(CN1CCN(c2ccc(Br)cc2)CC1)N1CCCCC1)OCc1ccccc1 |
| InChI | InChI=1S/C26H34BrN3O2/c27-23-9-11-24(12-10-23)30-17-15-28(16-18-30)20-25(29-13-5-2-6-14-29)19-26(31)32-21-22-7-3-1-4-8-22/h1,3-4,7-12,25H,2,5-6,13-21H2 |
| InChIKey | OLFWGZLWGLVEPB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |