C54H39N3O — CID 168802688
2-(6,6-dimethylbenzo[c]chromen-4-yl)-4,6-bis(3,5-diphenylphenyl)-1,3,5-triazine (PubChem CID 168802688) has the molecular formula C54H39N3O and a molecular weight of 745.93 g/mol. Its IUPAC name is 2-(6,6-dimethylbenzo[c]chromen-4-yl)-4,6-bis(3,5-diphenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(6,6-dimethylbenzo[c]chromen-4-yl)-4,6-bis(3,5-diphenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 168802688 |
| Molecular Formula | C54H39N3O |
| Molecular Weight | 745.93 g/mol |
| Exact Mass | 745.31 |
| IUPAC Name | 2-(6,6-dimethylbenzo[c]chromen-4-yl)-4,6-bis(3,5-diphenylphenyl)-1,3,5-triazine |
| SMILES | CC1(C)Oc2c(-c3nc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)nc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)n3)cccc2-c2ccccc21 |
| InChI | InChI=1S/C54H39N3O/c1-54(2)49-29-16-15-26-46(49)47-27-17-28-48(50(47)58-54)53-56-51(44-32-40(36-18-7-3-8-19-36)30-41(33-44)37-20-9-4-10-21-37)55-52(57-53)45-34-42(38-22-11-5-12-23-38)31-43(35-45)39-24-13-6-14-25-39/h3-35H,1-2H3 |
| InChIKey | IFEDTLMNLOGXRW-UHFFFAOYSA-N |
| XLogP | 13.84 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.93 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |