C51H32N4O — CID 168802899
2-[3-(9-isocyano-6,6-diphenylbenzo[c]chromen-3-yl)phenyl]-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine (PubChem CID 168802899) has the molecular formula C51H32N4O and a molecular weight of 716.84 g/mol. Its IUPAC name is 2-[3-(9-isocyano-6,6-diphenylbenzo[c]chromen-3-yl)phenyl]-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[3-(9-isocyano-6,6-diphenylbenzo[c]chromen-3-yl)phenyl]-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 168802899 |
| Molecular Formula | C51H32N4O |
| Molecular Weight | 716.84 g/mol |
| Exact Mass | 716.26 |
| IUPAC Name | 2-[3-(9-isocyano-6,6-diphenylbenzo[c]chromen-3-yl)phenyl]-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc2c(c1)-c1ccc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccc6ccccc6c5)n4)c3)cc1OC2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C51H32N4O/c1-52-43-27-29-46-45(33-43)44-28-26-38(32-47(44)56-51(46,41-20-7-3-8-21-41)42-22-9-4-10-23-42)37-18-13-19-39(31-37)49-53-48(35-15-5-2-6-16-35)54-50(55-49)40-25-24-34-14-11-12-17-36(34)30-40/h2-33H |
| InChIKey | QUTTURUIIMWLRC-UHFFFAOYSA-N |
| XLogP | 12.59 |
| TPSA | 52.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.84 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|