C17H31N3 — CID 168819929
N-tert-butyl-1,3-bis[(E)-pent-2-enyl]imidazolidin-2-imine (PubChem CID 168819929) has the molecular formula C17H31N3 and a molecular weight of 277.46 g/mol. Its IUPAC name is N-tert-butyl-1,3-bis[(E)-pent-2-enyl]imidazolidin-2-imine.
| Compound Name | N-tert-butyl-1,3-bis[(E)-pent-2-enyl]imidazolidin-2-imine |
|---|---|
| PubChem CID | 168819929 |
| Molecular Formula | C17H31N3 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.25 |
| IUPAC Name | N-tert-butyl-1,3-bis[(E)-pent-2-enyl]imidazolidin-2-imine |
| SMILES | CC/C=C/CN1CCN(C/C=C/CC)C1=NC(C)(C)C |
| InChI | InChI=1S/C17H31N3/c1-6-8-10-12-19-14-15-20(13-11-9-7-2)16(19)18-17(3,4)5/h8-11H,6-7,12-15H2,1-5H3/b10-8+,11-9+ |
| InChIKey | CBQHBTPGJUVSTN-GFULKKFKSA-N |
| XLogP | 3.69 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|