C12H23N3 — CID 168819944
N-tert-butyl-1-[(E)-pent-2-enyl]-4,5-dihydroimidazol-2-amine (PubChem CID 168819944) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is N-tert-butyl-1-[(E)-pent-2-enyl]-4,5-dihydroimidazol-2-amine.
| Compound Name | N-tert-butyl-1-[(E)-pent-2-enyl]-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 168819944 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | N-tert-butyl-1-[(E)-pent-2-enyl]-4,5-dihydroimidazol-2-amine |
| SMILES | CC/C=C/CN1CCN=C1NC(C)(C)C |
| InChI | InChI=1S/C12H23N3/c1-5-6-7-9-15-10-8-13-11(15)14-12(2,3)4/h6-7H,5,8-10H2,1-4H3,(H,13,14)/b7-6+ |
| InChIKey | SEPKLIDKNQDASS-VOTSOKGWSA-N |
| XLogP | 2.01 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|