C50H41N3Pt — CID 168820079
3',6'-ditert-butyl-2-[2-(6-methyl-2-pyridinyl)-1H-carbazol-1-id-9-yl]spiro[9H-indeno[1,2-b]pyridin-9-ide-5,9'-fluorene];platinum(2+) (PubChem CID 168820079) has the molecular formula C50H41N3Pt and a molecular weight of 878.98 g/mol. Its IUPAC name is 3',6'-ditert-butyl-2-[2-(6-methyl-2-pyridinyl)-1H-carbazol-1-id-9-yl]spiro[9H-indeno[1,2-b]pyridin-9-ide-5,9'-fluorene];platinum(2+).
| Compound Name | 3',6'-ditert-butyl-2-[2-(6-methyl-2-pyridinyl)-1H-carbazol-1-id-9-yl]spiro[9H-indeno[1,2-b]pyridin-9-ide-5,9'-fluorene];platinum(2+) |
|---|---|
| PubChem CID | 168820079 |
| Molecular Formula | C50H41N3Pt |
| Molecular Weight | 878.98 g/mol |
| Exact Mass | 878.29 |
| IUPAC Name | 3',6'-ditert-butyl-2-[2-(6-methyl-2-pyridinyl)-1H-carbazol-1-id-9-yl]spiro[9H-indeno[1,2-b]pyridin-9-ide-5,9'-fluorene];platinum(2+) |
| SMILES | Cc1cccc(-c2[c-]c3c(cc2)c2ccccc2n3-c2ccc3c(n2)-c2[c-]cccc2C32c3ccc(C(C)(C)C)cc3-c3cc(C(C)(C)C)ccc32)n1.[Pt+2] |
| InChI | InChI=1S/C50H41N3.Pt/c1-30-13-12-17-43(51-30)31-19-22-35-34-14-9-11-18-44(34)53(45(35)27-31)46-26-25-42-47(52-46)36-15-8-10-16-39(36)50(42)40-23-20-32(48(2,3)4)28-37(40)38-29-33(49(5,6)7)21-24-41(38)50;/h8-14,16-26,28-29H,1-7H3;/q-2;+2 |
| InChIKey | QDNZWSOGUUJNPA-UHFFFAOYSA-N |
| XLogP | 12.09 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.98 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|