C14H16N4O — CID 168830568
(1S,9R)-11-benzyl-8-oxa-3,4,5,11-tetrazatricyclo[7.3.0.02,6]dodeca-2,5-diene (PubChem CID 168830568) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is (1S,9R)-11-benzyl-8-oxa-3,4,5,11-tetrazatricyclo[7.3.0.02,6]dodeca-2,5-diene.
| Compound Name | (1S,9R)-11-benzyl-8-oxa-3,4,5,11-tetrazatricyclo[7.3.0.02,6]dodeca-2,5-diene |
|---|---|
| PubChem CID | 168830568 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (1S,9R)-11-benzyl-8-oxa-3,4,5,11-tetrazatricyclo[7.3.0.02,6]dodeca-2,5-diene |
| SMILES | c1ccc(CN2C[C@@H]3OCc4n[nH]nc4[C@@H]3C2)cc1 |
| InChI | InChI=1S/C14H16N4O/c1-2-4-10(5-3-1)6-18-7-11-13(8-18)19-9-12-14(11)16-17-15-12/h1-5,11,13H,6-9H2,(H,15,16,17)/t11-,13+/m1/s1 |
| InChIKey | QQOZFECFHFASKX-YPMHNXCESA-N |
| XLogP | 1.30 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |