C35H42N4O16 — CID 168846849
[4-[[1-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate (PubChem CID 168846849) has the molecular formula C35H42N4O16 and a molecular weight of 774.73 g/mol. Its IUPAC name is [4-[[1-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [4-[[1-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 168846849 |
| Molecular Formula | C35H42N4O16 |
| Molecular Weight | 774.73 g/mol |
| Exact Mass | 774.26 |
| IUPAC Name | [4-[[1-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
| SMILES | NCCOCCOCCOCCOCCn1cc(COC2c3c(O)cc(O)cc3OC(c3cc(O)c(O)c(O)c3)C2OC(=O)c2cc(O)c(O)c(O)c2)nn1 |
| InChI | InChI=1S/C35H42N4O16/c36-1-3-49-5-7-51-9-10-52-8-6-50-4-2-39-17-21(37-38-39)18-53-33-29-23(41)15-22(40)16-28(29)54-32(19-11-24(42)30(46)25(43)12-19)34(33)55-35(48)20-13-26(44)31(47)27(45)14-20/h11-17,32-34,40-47H,1-10,18,36H2 |
| InChIKey | XMMIJDKSMJBTNC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 300.25 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.73 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|