C28H30FNO12 — CID 168846782
[4-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3-fluoro-4-hydroxybenzoate (PubChem CID 168846782) has the molecular formula C28H30FNO12 and a molecular weight of 591.54 g/mol. Its IUPAC name is [4-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3-fluoro-4-hydroxybenzoate.
| Compound Name | [4-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3-fluoro-4-hydroxybenzoate |
|---|---|
| PubChem CID | 168846782 |
| Molecular Formula | C28H30FNO12 |
| Molecular Weight | 591.54 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | [4-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3-fluoro-4-hydroxybenzoate |
| SMILES | NCCOCCOCCOC1c2c(O)cc(O)cc2OC(c2cc(O)c(O)c(O)c2)C1OC(=O)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C28H30FNO12/c29-17-9-14(1-2-18(17)32)28(37)42-27-25(15-10-20(34)24(36)21(35)11-15)41-22-13-16(31)12-19(33)23(22)26(27)40-8-7-39-6-5-38-4-3-30/h1-2,9-13,25-27,31-36H,3-8,30H2 |
| InChIKey | KLJVOJUKCMWEFF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 210.62 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.54 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|