C19H30N6O — CID 168857400
4-N-[4-[(E)-1-amino-3-methylimino-1-(oxan-4-yl)prop-1-en-2-yl]pyrimidin-2-yl]cyclohexane-1,4-diamine (PubChem CID 168857400) has the molecular formula C19H30N6O and a molecular weight of 358.49 g/mol. Its IUPAC name is 4-N-[4-[(E)-1-amino-3-methylimino-1-(oxan-4-yl)prop-1-en-2-yl]pyrimidin-2-yl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[4-[(E)-1-amino-3-methylimino-1-(oxan-4-yl)prop-1-en-2-yl]pyrimidin-2-yl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 168857400 |
| Molecular Formula | C19H30N6O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 4-N-[4-[(E)-1-amino-3-methylimino-1-(oxan-4-yl)prop-1-en-2-yl]pyrimidin-2-yl]cyclohexane-1,4-diamine |
| SMILES | C/N=C/C(=C(\N)C1CCOCC1)c1ccnc(NC2CCC(N)CC2)n1 |
| InChI | InChI=1S/C19H30N6O/c1-22-12-16(18(21)13-7-10-26-11-8-13)17-6-9-23-19(25-17)24-15-4-2-14(20)3-5-15/h6,9,12-15H,2-5,7-8,10-11,20-21H2,1H3,(H,23,24,25)/b18-16+,22-12+ |
| InChIKey | KWGSPRDAJCRPHI-PEDQKWNDSA-N |
| XLogP | 1.96 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|