C23H19F3N4O2 — CID 168873147
N-(3-hydroxycyclobutyl)-N-[5-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]-1H-indol-3-yl]formamide (PubChem CID 168873147) has the molecular formula C23H19F3N4O2 and a molecular weight of 440.43 g/mol. Its IUPAC name is N-(3-hydroxycyclobutyl)-N-[5-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]-1H-indol-3-yl]formamide.
| Compound Name | N-(3-hydroxycyclobutyl)-N-[5-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]-1H-indol-3-yl]formamide |
|---|---|
| PubChem CID | 168873147 |
| Molecular Formula | C23H19F3N4O2 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-(3-hydroxycyclobutyl)-N-[5-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]-1H-indol-3-yl]formamide |
| SMILES | O=CN(c1c[nH]c2ccc(-c3cnn(-c4ccc(C(F)(F)F)cc4)c3)cc12)C1CC(O)C1 |
| InChI | InChI=1S/C23H19F3N4O2/c24-23(25,26)16-2-4-17(5-3-16)30-12-15(10-28-30)14-1-6-21-20(7-14)22(11-27-21)29(13-31)18-8-19(32)9-18/h1-7,10-13,18-19,27,32H,8-9H2 |
| InChIKey | DYLMGMOWRMIDMK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|