C10H21O3Si2 — CID 168877304
CID 168877304 (PubChem CID 168877304) has the molecular formula C10H21O3Si2 and a molecular weight of 245.45 g/mol.
| Compound Name | CID 168877304 |
|---|---|
| PubChem CID | 168877304 |
| Molecular Formula | C10H21O3Si2 |
| Molecular Weight | 245.45 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | — |
| SMILES | C=CC(=O)OC[Si](C)O[Si](C)(C)C(C)C |
| InChI | InChI=1S/C10H21O3Si2/c1-7-10(11)12-8-14(4)13-15(5,6)9(2)3/h7,9H,1,8H2,2-6H3 |
| InChIKey | LITKFLMRRYIXQV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|