C27H54B3N3O9Si3 — CID 132530440
2-[1-[4,6-bis[1-[dimethyl(2-prop-2-enoyloxyethoxy)silyl]ethyl]-1,3,5,2,4,6-triazatriborinan-2-yl]ethyl-dimethylsilyl]oxyethyl prop-2-enoate (PubChem CID 132530440) has the molecular formula C27H54B3N3O9Si3 and a molecular weight of 681.43 g/mol. Its IUPAC name is 2-[1-[4,6-bis[1-[dimethyl(2-prop-2-enoyloxyethoxy)silyl]ethyl]-1,3,5,2,4,6-triazatriborinan-2-yl]ethyl-dimethylsilyl]oxyethyl prop-2-enoate.
| Compound Name | 2-[1-[4,6-bis[1-[dimethyl(2-prop-2-enoyloxyethoxy)silyl]ethyl]-1,3,5,2,4,6-triazatriborinan-2-yl]ethyl-dimethylsilyl]oxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 132530440 |
| Molecular Formula | C27H54B3N3O9Si3 |
| Molecular Weight | 681.43 g/mol |
| Exact Mass | 681.34 |
| IUPAC Name | 2-[1-[4,6-bis[1-[dimethyl(2-prop-2-enoyloxyethoxy)silyl]ethyl]-1,3,5,2,4,6-triazatriborinan-2-yl]ethyl-dimethylsilyl]oxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCO[Si](C)(C)C(C)B1NB(C(C)[Si](C)(C)OCCOC(=O)C=C)NB(C(C)[Si](C)(C)OCCOC(=O)C=C)N1 |
| InChI | InChI=1S/C27H54B3N3O9Si3/c1-13-25(34)37-16-19-40-43(7,8)22(4)28-31-29(23(5)44(9,10)41-20-17-38-26(35)14-2)33-30(32-28)24(6)45(11,12)42-21-18-39-27(36)15-3/h13-15,22-24,31-33H,1-3,16-21H2,4-12H3 |
| InChIKey | CVKDIPYKIVFUPL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 142.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|