C33H65N3 — CID 168879558
9-[(Z)-but-2-en-2-yl]imino-8-N,8-N-di(nonyl)undec-10-ene-1,8-diamine (PubChem CID 168879558) has the molecular formula C33H65N3 and a molecular weight of 503.90 g/mol. Its IUPAC name is 9-[(Z)-but-2-en-2-yl]imino-8-N,8-N-di(nonyl)undec-10-ene-1,8-diamine.
| Compound Name | 9-[(Z)-but-2-en-2-yl]imino-8-N,8-N-di(nonyl)undec-10-ene-1,8-diamine |
|---|---|
| PubChem CID | 168879558 |
| Molecular Formula | C33H65N3 |
| Molecular Weight | 503.90 g/mol |
| Exact Mass | 503.52 |
| IUPAC Name | 9-[(Z)-but-2-en-2-yl]imino-8-N,8-N-di(nonyl)undec-10-ene-1,8-diamine |
| SMILES | C=C/C(=N\C(C)=C/C)C(CCCCCCCN)N(CCCCCCCCC)CCCCCCCCC |
| InChI | InChI=1S/C33H65N3/c1-6-10-12-14-16-21-25-29-36(30-26-22-17-15-13-11-7-2)33(27-23-19-18-20-24-28-34)32(9-4)35-31(5)8-3/h8-9,33H,4,6-7,10-30,34H2,1-3,5H3/b31-8-,35-32+ |
| InChIKey | XUFVFEPEFUSBGX-GFSNULSPSA-N |
| XLogP | 10.01 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.90 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|