C30H47N5O6 — CID 168881988
tert-butyl formate;N-[2-(cyclohexylamino)-6-[(2,6-dioxopiperidin-3-yl)-methylamino]phenyl]-N-methylformamide;pyrrolidine-1-carbaldehyde (PubChem CID 168881988) has the molecular formula C30H47N5O6 and a molecular weight of 573.74 g/mol. Its IUPAC name is tert-butyl formate;N-[2-(cyclohexylamino)-6-[(2,6-dioxopiperidin-3-yl)-methylamino]phenyl]-N-methylformamide;pyrrolidine-1-carbaldehyde.
| Compound Name | tert-butyl formate;N-[2-(cyclohexylamino)-6-[(2,6-dioxopiperidin-3-yl)-methylamino]phenyl]-N-methylformamide;pyrrolidine-1-carbaldehyde |
|---|---|
| PubChem CID | 168881988 |
| Molecular Formula | C30H47N5O6 |
| Molecular Weight | 573.74 g/mol |
| Exact Mass | 573.35 |
| IUPAC Name | tert-butyl formate;N-[2-(cyclohexylamino)-6-[(2,6-dioxopiperidin-3-yl)-methylamino]phenyl]-N-methylformamide;pyrrolidine-1-carbaldehyde |
| SMILES | CC(C)(C)OC=O.CN(C=O)c1c(NC2CCCCC2)cccc1N(C)C1CCC(=O)NC1=O.O=CN1CCCC1 |
| InChI | InChI=1S/C20H28N4O3.C5H9NO.C5H10O2/c1-23(13-25)19-15(21-14-7-4-3-5-8-14)9-6-10-16(19)24(2)17-11-12-18(26)22-20(17)27;7-5-6-3-1-2-4-6;1-5(2,3)7-4-6/h6,9-10,13-14,17,21H,3-5,7-8,11-12H2,1-2H3,(H,22,26,27);5H,1-4H2;4H,1-3H3 |
| InChIKey | VHEYDAYVVZHIIS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.74 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|