C22H28N4O5 — CID 168882526
(3R)-1-[4-[[5-(2,6-dioxopiperidin-3-yl)-3-pyridinyl]amino]cyclohexanecarbonyl]pyrrolidine-3-carboxylic acid (PubChem CID 168882526) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is (3R)-1-[4-[[5-(2,6-dioxopiperidin-3-yl)-3-pyridinyl]amino]cyclohexanecarbonyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3R)-1-[4-[[5-(2,6-dioxopiperidin-3-yl)-3-pyridinyl]amino]cyclohexanecarbonyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 168882526 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | (3R)-1-[4-[[5-(2,6-dioxopiperidin-3-yl)-3-pyridinyl]amino]cyclohexanecarbonyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C1CCC(c2cncc(NC3CCC(C(=O)N4CC[C@@H](C(=O)O)C4)CC3)c2)C(=O)N1 |
| InChI | InChI=1S/C22H28N4O5/c27-19-6-5-18(20(28)25-19)15-9-17(11-23-10-15)24-16-3-1-13(2-4-16)21(29)26-8-7-14(12-26)22(30)31/h9-11,13-14,16,18,24H,1-8,12H2,(H,30,31)(H,25,27,28)/t13?,14-,16?,18?/m1/s1 |
| InChIKey | DRKZSNKMXLYJJX-ZJKLVQPKSA-N |
| XLogP | 1.51 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|