C24H26F3N5O2S — CID 168888958
methyl 5-[2-[2-ethyl-4-(4-methylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]thiophene-3-carboxylate (PubChem CID 168888958) has the molecular formula C24H26F3N5O2S and a molecular weight of 505.57 g/mol. Its IUPAC name is methyl 5-[2-[2-ethyl-4-(4-methylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]thiophene-3-carboxylate.
| Compound Name | methyl 5-[2-[2-ethyl-4-(4-methylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 168888958 |
| Molecular Formula | C24H26F3N5O2S |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | methyl 5-[2-[2-ethyl-4-(4-methylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]thiophene-3-carboxylate |
| SMILES | CCc1cc(N2CCN(C)CC2)ccc1Nc1ncc(C(F)(F)F)c(-c2cc(C(=O)OC)cs2)n1 |
| InChI | InChI=1S/C24H26F3N5O2S/c1-4-15-11-17(32-9-7-31(2)8-10-32)5-6-19(15)29-23-28-13-18(24(25,26)27)21(30-23)20-12-16(14-35-20)22(33)34-3/h5-6,11-14H,4,7-10H2,1-3H3,(H,28,29,30) |
| InChIKey | OIXBEHZLSMZSGS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|