C10H14N2 — CID 168895440
1-ethenyl-N,3,5-trimethylpyridin-2-imine (PubChem CID 168895440) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 1-ethenyl-N,3,5-trimethylpyridin-2-imine.
| Compound Name | 1-ethenyl-N,3,5-trimethylpyridin-2-imine |
|---|---|
| PubChem CID | 168895440 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1-ethenyl-N,3,5-trimethylpyridin-2-imine |
| SMILES | C=Cn1cc(C)cc(C)/c1=N\C |
| InChI | InChI=1S/C10H14N2/c1-5-12-7-8(2)6-9(3)10(12)11-4/h5-7H,1H2,2-4H3/b11-10+ |
| InChIKey | ICNGLXWWDXQLLO-ZHACJKMWSA-N |
| XLogP | 1.74 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |