C14H17Cl2NO7 — CID 168895977
3,6-dichloro-2-methoxy-N-[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl]benzamide (PubChem CID 168895977) has the molecular formula C14H17Cl2NO7 and a molecular weight of 382.20 g/mol. Its IUPAC name is 3,6-dichloro-2-methoxy-N-[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl]benzamide.
| Compound Name | 3,6-dichloro-2-methoxy-N-[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl]benzamide |
|---|---|
| PubChem CID | 168895977 |
| Molecular Formula | C14H17Cl2NO7 |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 3,6-dichloro-2-methoxy-N-[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl]benzamide |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)NC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C14H17Cl2NO7/c1-24-13-7(16)3-2-6(15)10(13)14(23)17-4-8(19)11(21)12(22)9(20)5-18/h2-3,5,8-9,11-12,19-22H,4H2,1H3,(H,17,23)/t8-,9+,11-,12-/m1/s1 |
| InChIKey | ZGHUJXHFECTUKW-RBLKWDMZSA-N |
| XLogP | -0.63 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|