C23H30N6O2 — CID 168901465
2-[6-amino-5-[5-[(3E)-5-iminopenta-1,3-dien-3-yl]-2-oxa-5,8-diazaspiro[3.5]nonan-8-yl]pyridazin-3-yl]phenol;ethane (PubChem CID 168901465) has the molecular formula C23H30N6O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[6-amino-5-[5-[(3E)-5-iminopenta-1,3-dien-3-yl]-2-oxa-5,8-diazaspiro[3.5]nonan-8-yl]pyridazin-3-yl]phenol;ethane.
| Compound Name | 2-[6-amino-5-[5-[(3E)-5-iminopenta-1,3-dien-3-yl]-2-oxa-5,8-diazaspiro[3.5]nonan-8-yl]pyridazin-3-yl]phenol;ethane |
|---|---|
| PubChem CID | 168901465 |
| Molecular Formula | C23H30N6O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 2-[6-amino-5-[5-[(3E)-5-iminopenta-1,3-dien-3-yl]-2-oxa-5,8-diazaspiro[3.5]nonan-8-yl]pyridazin-3-yl]phenol;ethane |
| SMILES | CC.[H]/N=C/C=C(\C=C)N1CCN(c2cc(-c3ccccc3O)nnc2N)CC12COC2 |
| InChI | InChI=1S/C21H24N6O2.C2H6/c1-2-15(7-8-22)27-10-9-26(12-21(27)13-29-14-21)18-11-17(24-25-20(18)23)16-5-3-4-6-19(16)28;1-2/h2-8,11,22,28H,1,9-10,12-14H2,(H2,23,25);1-2H3/b15-7+,22-8+; |
| InChIKey | LKYHUGDAXCVKLL-BTILSHCVSA-N |
| XLogP | 3.07 |
| TPSA | 111.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|