C20H21BrF4N2O — CID 168904781
2-bromo-5-[2-fluoro-4-(trifluoromethoxy)phenyl]-3-N,4-dimethyl-3-N-prop-1-ynylbenzene-1,3-diamine;ethane (PubChem CID 168904781) has the molecular formula C20H21BrF4N2O and a molecular weight of 461.30 g/mol. Its IUPAC name is 2-bromo-5-[2-fluoro-4-(trifluoromethoxy)phenyl]-3-N,4-dimethyl-3-N-prop-1-ynylbenzene-1,3-diamine;ethane.
| Compound Name | 2-bromo-5-[2-fluoro-4-(trifluoromethoxy)phenyl]-3-N,4-dimethyl-3-N-prop-1-ynylbenzene-1,3-diamine;ethane |
|---|---|
| PubChem CID | 168904781 |
| Molecular Formula | C20H21BrF4N2O |
| Molecular Weight | 461.30 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 2-bromo-5-[2-fluoro-4-(trifluoromethoxy)phenyl]-3-N,4-dimethyl-3-N-prop-1-ynylbenzene-1,3-diamine;ethane |
| SMILES | CC.CC#CN(C)c1c(C)c(-c2ccc(OC(F)(F)F)cc2F)cc(N)c1Br |
| InChI | InChI=1S/C18H15BrF4N2O.C2H6/c1-4-7-25(3)17-10(2)13(9-15(24)16(17)19)12-6-5-11(8-14(12)20)26-18(21,22)23;1-2/h5-6,8-9H,24H2,1-3H3;1-2H3 |
| InChIKey | HUIBBHJQZDFZFY-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.30 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|