C21H20F3NO3U — CID 168905470
N-[1-[3-ethyl-2-(hydroxymethyl)-5-[4-(trifluoromethoxy)phenyl]benzene-4-id-1-yl]ethyl]prop-2-enamide;uranium(2+) (PubChem CID 168905470) has the molecular formula C21H20F3NO3U and a molecular weight of 629.42 g/mol. Its IUPAC name is N-[1-[3-ethyl-2-(hydroxymethyl)-5-[4-(trifluoromethoxy)phenyl]benzene-4-id-1-yl]ethyl]prop-2-enamide;uranium(2+).
| Compound Name | N-[1-[3-ethyl-2-(hydroxymethyl)-5-[4-(trifluoromethoxy)phenyl]benzene-4-id-1-yl]ethyl]prop-2-enamide;uranium(2+) |
|---|---|
| PubChem CID | 168905470 |
| Molecular Formula | C21H20F3NO3U |
| Molecular Weight | 629.42 g/mol |
| Exact Mass | 629.19 |
| IUPAC Name | N-[1-[3-ethyl-2-(hydroxymethyl)-5-[4-(trifluoromethoxy)phenyl]benzene-4-id-1-yl]ethyl]prop-2-enamide;uranium(2+) |
| SMILES | C=CC(=O)NC(C)c1cc(-c2ccc(OC(F)(F)F)cc2)[c-]c(C[CH2-])c1CO.[U+2] |
| InChI | InChI=1S/C21H20F3NO3.U/c1-4-14-10-16(15-6-8-17(9-7-15)28-21(22,23)24)11-18(19(14)12-26)13(3)25-20(27)5-2;/h5-9,11,13,26H,1-2,4,12H2,3H3,(H,25,27);/q-2;+2 |
| InChIKey | HFFHWDQYHWMBSL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|