C22H24F3NO3U — CID 168904978
N-[[2-(hydroxymethyl)-3-propyl-5-[4-(trifluoromethoxy)phenyl]benzene-4-id-1-yl]methyl]formamide;prop-1-ene;uranium(2+) (PubChem CID 168904978) has the molecular formula C22H24F3NO3U and a molecular weight of 645.46 g/mol. Its IUPAC name is N-[[2-(hydroxymethyl)-3-propyl-5-[4-(trifluoromethoxy)phenyl]benzene-4-id-1-yl]methyl]formamide;prop-1-ene;uranium(2+).
| Compound Name | N-[[2-(hydroxymethyl)-3-propyl-5-[4-(trifluoromethoxy)phenyl]benzene-4-id-1-yl]methyl]formamide;prop-1-ene;uranium(2+) |
|---|---|
| PubChem CID | 168904978 |
| Molecular Formula | C22H24F3NO3U |
| Molecular Weight | 645.46 g/mol |
| Exact Mass | 645.22 |
| IUPAC Name | N-[[2-(hydroxymethyl)-3-propyl-5-[4-(trifluoromethoxy)phenyl]benzene-4-id-1-yl]methyl]formamide;prop-1-ene;uranium(2+) |
| SMILES | C=CC.[CH2-]CCc1[c-]c(-c2ccc(OC(F)(F)F)cc2)cc(CNC=O)c1CO.[U+2] |
| InChI | InChI=1S/C19H18F3NO3.C3H6.U/c1-2-3-14-8-15(9-16(10-23-12-25)18(14)11-24)13-4-6-17(7-5-13)26-19(20,21)22;1-3-2;/h4-7,9,12,24H,1-3,10-11H2,(H,23,25);3H,1H2,2H3;/q-2;;+2 |
| InChIKey | POQGQRWYFAIXHJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|