C23H25F3N2O4 — CID 168905269
N-[[5-(1,2-dihydroxyethyl)-8-[4-(trifluoromethoxy)phenyl]-1,2-dihydroquinolin-6-yl]methyl]formamide;prop-1-ene (PubChem CID 168905269) has the molecular formula C23H25F3N2O4 and a molecular weight of 450.46 g/mol. Its IUPAC name is N-[[5-(1,2-dihydroxyethyl)-8-[4-(trifluoromethoxy)phenyl]-1,2-dihydroquinolin-6-yl]methyl]formamide;prop-1-ene.
| Compound Name | N-[[5-(1,2-dihydroxyethyl)-8-[4-(trifluoromethoxy)phenyl]-1,2-dihydroquinolin-6-yl]methyl]formamide;prop-1-ene |
|---|---|
| PubChem CID | 168905269 |
| Molecular Formula | C23H25F3N2O4 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | N-[[5-(1,2-dihydroxyethyl)-8-[4-(trifluoromethoxy)phenyl]-1,2-dihydroquinolin-6-yl]methyl]formamide;prop-1-ene |
| SMILES | C=CC.O=CNCc1cc(-c2ccc(OC(F)(F)F)cc2)c2c(c1C(O)CO)C=CCN2 |
| InChI | InChI=1S/C20H19F3N2O4.C3H6/c21-20(22,23)29-14-5-3-12(4-6-14)16-8-13(9-24-11-27)18(17(28)10-26)15-2-1-7-25-19(15)16;1-3-2/h1-6,8,11,17,25-26,28H,7,9-10H2,(H,24,27);3H,1H2,2H3 |
| InChIKey | CIYDFGZZEKOGOE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|