C19H30N2O — CID 168906162
N-[(4Z,6Z)-4-butan-2-yl-3-methylidene-2-methyliminodeca-4,6-dienyl]prop-2-enamide (PubChem CID 168906162) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is N-[(4Z,6Z)-4-butan-2-yl-3-methylidene-2-methyliminodeca-4,6-dienyl]prop-2-enamide.
| Compound Name | N-[(4Z,6Z)-4-butan-2-yl-3-methylidene-2-methyliminodeca-4,6-dienyl]prop-2-enamide |
|---|---|
| PubChem CID | 168906162 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | N-[(4Z,6Z)-4-butan-2-yl-3-methylidene-2-methyliminodeca-4,6-dienyl]prop-2-enamide |
| SMILES | C=CC(=O)NC/C(=N\C)C(=C)/C(=C\C=C/CCC)C(C)CC |
| InChI | InChI=1S/C19H30N2O/c1-7-10-11-12-13-17(15(4)8-2)16(5)18(20-6)14-21-19(22)9-3/h9,11-13,15H,3,5,7-8,10,14H2,1-2,4,6H3,(H,21,22)/b12-11-,17-13-,20-18+ |
| InChIKey | AYRKIOCNAAISQY-RAWDTJAJSA-N |
| XLogP | 4.24 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|