C22H22F3N3O2 — CID 168906448
N-[2-(2-cyano-6-methylphenyl)-2-methyliminoethyl]prop-2-enamide;1-methyl-4-(trifluoromethoxy)benzene (PubChem CID 168906448) has the molecular formula C22H22F3N3O2 and a molecular weight of 417.43 g/mol. Its IUPAC name is N-[2-(2-cyano-6-methylphenyl)-2-methyliminoethyl]prop-2-enamide;1-methyl-4-(trifluoromethoxy)benzene.
| Compound Name | N-[2-(2-cyano-6-methylphenyl)-2-methyliminoethyl]prop-2-enamide;1-methyl-4-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 168906448 |
| Molecular Formula | C22H22F3N3O2 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | N-[2-(2-cyano-6-methylphenyl)-2-methyliminoethyl]prop-2-enamide;1-methyl-4-(trifluoromethoxy)benzene |
| SMILES | C=CC(=O)NC/C(=N\C)c1c(C)cccc1C#N.Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H15N3O.C8H7F3O/c1-4-13(18)17-9-12(16-3)14-10(2)6-5-7-11(14)8-15;1-6-2-4-7(5-3-6)12-8(9,10)11/h4-7H,1,9H2,2-3H3,(H,17,18);2-5H,1H3/b16-12+; |
| InChIKey | TZWZBAFGSOAUTQ-CLNHMMGSSA-N |
| XLogP | 4.48 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|