C14H25NO3Si — CID 168916688
[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-pyridinyl]methanol (PubChem CID 168916688) has the molecular formula C14H25NO3Si and a molecular weight of 283.44 g/mol. Its IUPAC name is [4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-pyridinyl]methanol.
| Compound Name | [4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 168916688 |
| Molecular Formula | C14H25NO3Si |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | [4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-pyridinyl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OCCOc1ccnc(CO)c1 |
| InChI | InChI=1S/C14H25NO3Si/c1-14(2,3)19(4,5)18-9-8-17-13-6-7-15-12(10-13)11-16/h6-7,10,16H,8-9,11H2,1-5H3 |
| InChIKey | FSCFIXOFNHOCGF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|