C34H35N3O3 — CID 168920646
tert-butyl 6-(3-tritylimidazole-4-carbonyl)-2-azaspiro[3.3]heptane-2-carboxylate (PubChem CID 168920646) has the molecular formula C34H35N3O3 and a molecular weight of 533.67 g/mol. Its IUPAC name is tert-butyl 6-(3-tritylimidazole-4-carbonyl)-2-azaspiro[3.3]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-(3-tritylimidazole-4-carbonyl)-2-azaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 168920646 |
| Molecular Formula | C34H35N3O3 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | tert-butyl 6-(3-tritylimidazole-4-carbonyl)-2-azaspiro[3.3]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC(C(=O)c3cncn3C(c3ccccc3)(c3ccccc3)c3ccccc3)C2)C1 |
| InChI | InChI=1S/C34H35N3O3/c1-32(2,3)40-31(39)36-22-33(23-36)19-25(20-33)30(38)29-21-35-24-37(29)34(26-13-7-4-8-14-26,27-15-9-5-10-16-27)28-17-11-6-12-18-28/h4-18,21,24-25H,19-20,22-23H2,1-3H3 |
| InChIKey | IKXUIKDPFXJXMD-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|