C19H20FN3O2S — CID 168925711
N-[5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-yl]formamide;(2R)-2-methyloxane (PubChem CID 168925711) has the molecular formula C19H20FN3O2S and a molecular weight of 373.45 g/mol. Its IUPAC name is N-[5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-yl]formamide;(2R)-2-methyloxane.
| Compound Name | N-[5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-yl]formamide;(2R)-2-methyloxane |
|---|---|
| PubChem CID | 168925711 |
| Molecular Formula | C19H20FN3O2S |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N-[5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-yl]formamide;(2R)-2-methyloxane |
| SMILES | C[C@@H]1CCCCO1.O=CNc1ncc(-c2ccc3cnc(F)cc3c2)s1 |
| InChI | InChI=1S/C13H8FN3OS.C6H12O/c14-12-4-10-3-8(1-2-9(10)5-15-12)11-6-16-13(19-11)17-7-18;1-6-4-2-3-5-7-6/h1-7H,(H,16,17,18);6H,2-5H2,1H3/t;6-/m.1/s1 |
| InChIKey | SEEROQCCBIETCL-FCXZQVPUSA-N |
| XLogP | 4.64 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|