C16H23N5O2 — CID 168927829
3-ethynyl-1-[(3S,5R)-5-(methoxymethyl)-1-prop-2-enylpyrrolidin-3-yl]-5-(methylamino)pyrazole-4-carboxamide (PubChem CID 168927829) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 3-ethynyl-1-[(3S,5R)-5-(methoxymethyl)-1-prop-2-enylpyrrolidin-3-yl]-5-(methylamino)pyrazole-4-carboxamide.
| Compound Name | 3-ethynyl-1-[(3S,5R)-5-(methoxymethyl)-1-prop-2-enylpyrrolidin-3-yl]-5-(methylamino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 168927829 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 3-ethynyl-1-[(3S,5R)-5-(methoxymethyl)-1-prop-2-enylpyrrolidin-3-yl]-5-(methylamino)pyrazole-4-carboxamide |
| SMILES | C#Cc1nn([C@H]2C[C@H](COC)N(CC=C)C2)c(NC)c1C(N)=O |
| InChI | InChI=1S/C16H23N5O2/c1-5-7-20-9-11(8-12(20)10-23-4)21-16(18-3)14(15(17)22)13(6-2)19-21/h2,5,11-12,18H,1,7-10H2,3-4H3,(H2,17,22)/t11-,12+/m0/s1 |
| InChIKey | NKEIHFBGFIWIGO-NWDGAFQWSA-N |
| XLogP | 0.45 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|