C24H28ClN7O2 — CID 168927929
3-amino-5-[2-[5-amino-4-[(Z)-2-amino-1-cyclopropylethenyl]-2-chlorophenyl]ethynyl]-1H-pyrazole-4-carboxamide;1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 168927929) has the molecular formula C24H28ClN7O2 and a molecular weight of 481.99 g/mol. Its IUPAC name is 3-amino-5-[2-[5-amino-4-[(Z)-2-amino-1-cyclopropylethenyl]-2-chlorophenyl]ethynyl]-1H-pyrazole-4-carboxamide;1-pyrrolidin-1-ylprop-2-en-1-one.
| Compound Name | 3-amino-5-[2-[5-amino-4-[(Z)-2-amino-1-cyclopropylethenyl]-2-chlorophenyl]ethynyl]-1H-pyrazole-4-carboxamide;1-pyrrolidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 168927929 |
| Molecular Formula | C24H28ClN7O2 |
| Molecular Weight | 481.99 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 3-amino-5-[2-[5-amino-4-[(Z)-2-amino-1-cyclopropylethenyl]-2-chlorophenyl]ethynyl]-1H-pyrazole-4-carboxamide;1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC1.N/C=C(\c1cc(Cl)c(C#Cc2[nH]nc(N)c2C(N)=O)cc1N)C1CC1 |
| InChI | InChI=1S/C17H17ClN6O.C7H11NO/c18-12-6-10(11(7-19)8-1-2-8)13(20)5-9(12)3-4-14-15(17(22)25)16(21)24-23-14;1-2-7(9)8-5-3-4-6-8/h5-8H,1-2,19-20H2,(H2,22,25)(H3,21,23,24);2H,1,3-6H2/b11-7-; |
| InChIKey | XLUHSFIZTBWELL-AJULUCINSA-N |
| XLogP | 2.23 |
| TPSA | 170.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.99 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|