C35H39N5O6 — CID 168931872
3-[5-[2-[1-[[2,6-dimethoxy-4-(1,3,4-trimethyl-2-oxo-3,4-dihydropyridin-5-yl)phenyl]methyl]azetidin-3-yl]ethynyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 168931872) has the molecular formula C35H39N5O6 and a molecular weight of 625.73 g/mol. Its IUPAC name is 3-[5-[2-[1-[[2,6-dimethoxy-4-(1,3,4-trimethyl-2-oxo-3,4-dihydropyridin-5-yl)phenyl]methyl]azetidin-3-yl]ethynyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[2-[1-[[2,6-dimethoxy-4-(1,3,4-trimethyl-2-oxo-3,4-dihydropyridin-5-yl)phenyl]methyl]azetidin-3-yl]ethynyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 168931872 |
| Molecular Formula | C35H39N5O6 |
| Molecular Weight | 625.73 g/mol |
| Exact Mass | 625.29 |
| IUPAC Name | 3-[5-[2-[1-[[2,6-dimethoxy-4-(1,3,4-trimethyl-2-oxo-3,4-dihydropyridin-5-yl)phenyl]methyl]azetidin-3-yl]ethynyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | COc1cc(C2=CN(C)C(=O)C(C)C2C)cc(OC)c1CN1CC(C#Cc2ccc3c(c2)n(C)c(=O)n3C2CCC(=O)NC2=O)C1 |
| InChI | InChI=1S/C35H39N5O6/c1-20-21(2)34(43)37(3)18-25(20)24-14-30(45-5)26(31(15-24)46-6)19-39-16-23(17-39)8-7-22-9-10-27-29(13-22)38(4)35(44)40(27)28-11-12-32(41)36-33(28)42/h9-10,13-15,18,20-21,23,28H,11-12,16-17,19H2,1-6H3,(H,36,41,42) |
| InChIKey | SXKPLFBTYZJIQZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.73 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|