C19H26 — CID 168937681
1-[(2Z,4E,6E)-7-methylnona-2,4,6-trien-5-yl]-3-propan-2-ylbenzene (PubChem CID 168937681) has the molecular formula C19H26 and a molecular weight of 254.42 g/mol. Its IUPAC name is 1-[(2Z,4E,6E)-7-methylnona-2,4,6-trien-5-yl]-3-propan-2-ylbenzene.
| Compound Name | 1-[(2Z,4E,6E)-7-methylnona-2,4,6-trien-5-yl]-3-propan-2-ylbenzene |
|---|---|
| PubChem CID | 168937681 |
| Molecular Formula | C19H26 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 1-[(2Z,4E,6E)-7-methylnona-2,4,6-trien-5-yl]-3-propan-2-ylbenzene |
| SMILES | C/C=C\C=C(/C=C(\C)CC)c1cccc(C(C)C)c1 |
| InChI | InChI=1S/C19H26/c1-6-8-10-18(13-16(5)7-2)19-12-9-11-17(14-19)15(3)4/h6,8-15H,7H2,1-5H3/b8-6-,16-13+,18-10+ |
| InChIKey | YTSIYDATKDLPKH-QGFRGXIGSA-N |
| XLogP | 6.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|