C20H22F4N2O2 — CID 168937934
1,3-dimethylpyrrolidin-2-one;N-(2-fluorophenyl)formamide;trifluoromethylbenzene (PubChem CID 168937934) has the molecular formula C20H22F4N2O2 and a molecular weight of 398.40 g/mol. Its IUPAC name is 1,3-dimethylpyrrolidin-2-one;N-(2-fluorophenyl)formamide;trifluoromethylbenzene.
| Compound Name | 1,3-dimethylpyrrolidin-2-one;N-(2-fluorophenyl)formamide;trifluoromethylbenzene |
|---|---|
| PubChem CID | 168937934 |
| Molecular Formula | C20H22F4N2O2 |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 1,3-dimethylpyrrolidin-2-one;N-(2-fluorophenyl)formamide;trifluoromethylbenzene |
| SMILES | CC1CCN(C)C1=O.FC(F)(F)c1ccccc1.O=CNc1ccccc1F |
| InChI | InChI=1S/C7H5F3.C7H6FNO.C6H11NO/c8-7(9,10)6-4-2-1-3-5-6;8-6-3-1-2-4-7(6)9-5-10;1-5-3-4-7(2)6(5)8/h1-5H;1-5H,(H,9,10);5H,3-4H2,1-2H3 |
| InChIKey | ZFLNLYBBWYUWHU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|