C28H26O6 — CID 168949593
methyl 4-[[2-hydroxy-3-(1-methoxyethenyl)naphthalen-1-yl]methyl]-3-[(S)-hydroxy(methoxy)methyl]naphthalene-2-carboxylate (PubChem CID 168949593) has the molecular formula C28H26O6 and a molecular weight of 458.51 g/mol. Its IUPAC name is methyl 4-[[2-hydroxy-3-(1-methoxyethenyl)naphthalen-1-yl]methyl]-3-[(S)-hydroxy(methoxy)methyl]naphthalene-2-carboxylate.
| Compound Name | methyl 4-[[2-hydroxy-3-(1-methoxyethenyl)naphthalen-1-yl]methyl]-3-[(S)-hydroxy(methoxy)methyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 168949593 |
| Molecular Formula | C28H26O6 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | methyl 4-[[2-hydroxy-3-(1-methoxyethenyl)naphthalen-1-yl]methyl]-3-[(S)-hydroxy(methoxy)methyl]naphthalene-2-carboxylate |
| SMILES | C=C(OC)c1cc2ccccc2c(Cc2c([C@@H](O)OC)c(C(=O)OC)cc3ccccc23)c1O |
| InChI | InChI=1S/C28H26O6/c1-16(32-2)21-13-17-9-6-8-12-20(17)23(26(21)29)15-22-19-11-7-5-10-18(19)14-24(27(30)33-3)25(22)28(31)34-4/h5-14,28-29,31H,1,15H2,2-4H3/t28-/m0/s1 |
| InChIKey | FIRXVUKEQIOCCW-NDEPHWFRSA-N |
| XLogP | 5.33 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|